About 1-(3-methoxyphenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide
1-(3-methoxyphenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide (PubChem CID 51083269) has the molecular formula C15H18N2O4S
and a molecular weight of 322.39 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide.
Molecular Properties
| Compound Name | 1-(3-methoxyphenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide |
| PubChem CID | 51083269 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-(3-methoxyphenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide |
| SMILES | COc1cccc(-n2c(C)cc(C(=O)NS(C)(=O)=O)c2C)c1 |
| InChI | InChI=1S/C15H18N2O4S/c1-10-8-14(15(18)16-22(4,19)20)11(2)17(10)12-6-5-7-13(9-12)21-3/h5-9H,1-4H3,(H,16,18) |
| InChIKey | PENDCQGRSDNSSU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methoxyphenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methoxyphenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide?
The IUPAC name of 1-(3-methoxyphenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide (CID 51083269) is 1-(3-methoxyphenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide.
What is the SMILES notation for 1-(3-methoxyphenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide?
The canonical SMILES for 1-(3-methoxyphenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide is COc1cccc(-n2c(C)cc(C(=O)NS(C)(=O)=O)c2C)c1.
What is the InChIKey of 1-(3-methoxyphenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide?
The InChIKey is PENDCQGRSDNSSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O4S/c1-10-8-14(15(18)16-22(4,19)20)11(2)17(10)12-6-5-7-13(9-12)21-3/h5-9H,1-4H3,(H,16,18).
What are the key properties of 1-(3-methoxyphenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide?
1-(3-methoxyphenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide has a molecular weight of 322.39 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methoxyphenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide is sourced from PubChem (CID 51083269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).