About 2-(3,5-dimethylpyrazol-1-yl)ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
2-(3,5-dimethylpyrazol-1-yl)ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 51083377) has the molecular formula C16H21N3O3
and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| PubChem CID | 51083377 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)OCCn2nc(C)cc2C)c1C |
| InChI | InChI=1S/C16H21N3O3/c1-9-8-10(2)19(18-9)6-7-22-16(21)15-11(3)14(13(5)20)12(4)17-15/h8,17H,6-7H2,1-5H3 |
| InChIKey | OKFTXHYIPMNBOY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,5-dimethylpyrazol-1-yl)ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethylpyrazol-1-yl)ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
The IUPAC name of 2-(3,5-dimethylpyrazol-1-yl)ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (CID 51083377) is 2-(3,5-dimethylpyrazol-1-yl)ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate.
What is the SMILES notation for 2-(3,5-dimethylpyrazol-1-yl)ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
The canonical SMILES for 2-(3,5-dimethylpyrazol-1-yl)ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate is CC(=O)c1c(C)[nH]c(C(=O)OCCn2nc(C)cc2C)c1C.
What is the InChIKey of 2-(3,5-dimethylpyrazol-1-yl)ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
The InChIKey is OKFTXHYIPMNBOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O3/c1-9-8-10(2)19(18-9)6-7-22-16(21)15-11(3)14(13(5)20)12(4)17-15/h8,17H,6-7H2,1-5H3.
What are the key properties of 2-(3,5-dimethylpyrazol-1-yl)ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
2-(3,5-dimethylpyrazol-1-yl)ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate has a molecular weight of 303.36 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethylpyrazol-1-yl)ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 51083377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).