C14H23N5O — CID 51083393
1-[2-(cyclohexen-1-yl)ethyl]-3-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]urea (PubChem CID 51083393) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]urea.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 51083393 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]urea |
| SMILES | CC(NC(=O)NCCC1=CCCCC1)c1nncn1C |
| InChI | InChI=1S/C14H23N5O/c1-11(13-18-16-10-19(13)2)17-14(20)15-9-8-12-6-4-3-5-7-12/h6,10-11H,3-5,7-9H2,1-2H3,(H2,15,17,20) |
| InChIKey | QHICJDBXLQOFPY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|