C15H23N3O4S — CID 51083543
3-(methanesulfonamido)-N-(2-phenoxyethyl)piperidine-1-carboxamide (PubChem CID 51083543) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is 3-(methanesulfonamido)-N-(2-phenoxyethyl)piperidine-1-carboxamide.
| Compound Name | 3-(methanesulfonamido)-N-(2-phenoxyethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 51083543 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-(methanesulfonamido)-N-(2-phenoxyethyl)piperidine-1-carboxamide |
| SMILES | CS(=O)(=O)NC1CCCN(C(=O)NCCOc2ccccc2)C1 |
| InChI | InChI=1S/C15H23N3O4S/c1-23(20,21)17-13-6-5-10-18(12-13)15(19)16-9-11-22-14-7-3-2-4-8-14/h2-4,7-8,13,17H,5-6,9-12H2,1H3,(H,16,19) |
| InChIKey | TWTFGRWYAJJOMC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|