C18H25N3O4 — CID 5108384
6-(2,2-dimethoxyethylamino)-1-[(3,5-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione (PubChem CID 5108384) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 6-(2,2-dimethoxyethylamino)-1-[(3,5-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione.
| Compound Name | 6-(2,2-dimethoxyethylamino)-1-[(3,5-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 5108384 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 6-(2,2-dimethoxyethylamino)-1-[(3,5-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione |
| SMILES | COC(CNc1cc(=O)n(C)c(=O)n1Cc1cc(C)cc(C)c1)OC |
| InChI | InChI=1S/C18H25N3O4/c1-12-6-13(2)8-14(7-12)11-21-15(19-10-17(24-4)25-5)9-16(22)20(3)18(21)23/h6-9,17,19H,10-11H2,1-5H3 |
| InChIKey | SMBIFYWYIJGJLJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|