About 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea
1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea (PubChem CID 51084056) has the molecular formula C15H20N6OS
and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea.
Molecular Properties
| Compound Name | 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea |
| PubChem CID | 51084056 |
| Molecular Formula | C15H20N6OS |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea |
| SMILES | Cc1nc(CNC(=O)NC2CCCN(c3ncccn3)C2)cs1 |
| InChI | InChI=1S/C15H20N6OS/c1-11-19-13(10-23-11)8-18-15(22)20-12-4-2-7-21(9-12)14-16-5-3-6-17-14/h3,5-6,10,12H,2,4,7-9H2,1H3,(H2,18,20,22) |
| InChIKey | GIMGEGUREKLNLF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea?
The IUPAC name of 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea (CID 51084056) is 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea.
What is the SMILES notation for 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea?
The canonical SMILES for 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea is Cc1nc(CNC(=O)NC2CCCN(c3ncccn3)C2)cs1.
What is the InChIKey of 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea?
The InChIKey is GIMGEGUREKLNLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N6OS/c1-11-19-13(10-23-11)8-18-15(22)20-12-4-2-7-21(9-12)14-16-5-3-6-17-14/h3,5-6,10,12H,2,4,7-9H2,1H3,(H2,18,20,22).
What are the key properties of 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea?
1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea has a molecular weight of 332.43 g/mol, XLogP of 1.71, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea is sourced from PubChem (CID 51084056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).