C17H23N5O2 — CID 51084129
1-(furan-3-ylmethyl)-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]urea (PubChem CID 51084129) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-(furan-3-ylmethyl)-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]urea.
| Compound Name | 1-(furan-3-ylmethyl)-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 51084129 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-(furan-3-ylmethyl)-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]urea |
| SMILES | CN1CCN(c2ccc(CNC(=O)NCc3ccoc3)cn2)CC1 |
| InChI | InChI=1S/C17H23N5O2/c1-21-5-7-22(8-6-21)16-3-2-14(10-18-16)11-19-17(23)20-12-15-4-9-24-13-15/h2-4,9-10,13H,5-8,11-12H2,1H3,(H2,19,20,23) |
| InChIKey | DCQXHPZUXVRMSI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |