C11H11NO5 — CID 5108455
5-(2,4-dimethoxyphenyl)-1,3-oxazolidine-2,4-dione (PubChem CID 5108455) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-(2,4-dimethoxyphenyl)-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 5108455 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)-1,3-oxazolidine-2,4-dione |
| SMILES | COc1ccc(C2OC(=O)NC2=O)c(OC)c1 |
| InChI | InChI=1S/C11H11NO5/c1-15-6-3-4-7(8(5-6)16-2)9-10(13)12-11(14)17-9/h3-5,9H,1-2H3,(H,12,13,14) |
| InChIKey | DYQPYOADVGRZGW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |