C30H44N2O5S — CID 5108583
N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(oxolan-2-ylmethyl)octanamide (PubChem CID 5108583) has the molecular formula C30H44N2O5S and a molecular weight of 544.76 g/mol. Its IUPAC name is N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(oxolan-2-ylmethyl)octanamide.
| Compound Name | N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(oxolan-2-ylmethyl)octanamide |
|---|---|
| PubChem CID | 5108583 |
| Molecular Formula | C30H44N2O5S |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(oxolan-2-ylmethyl)octanamide |
| SMILES | CCCCCCCC(=O)N(CC(=O)N(CCc1ccc(OC)c(OC)c1)Cc1cccs1)CC1CCCO1 |
| InChI | InChI=1S/C30H44N2O5S/c1-4-5-6-7-8-13-29(33)32(21-25-11-9-18-37-25)23-30(34)31(22-26-12-10-19-38-26)17-16-24-14-15-27(35-2)28(20-24)36-3/h10,12,14-15,19-20,25H,4-9,11,13,16-18,21-23H2,1-3H3 |
| InChIKey | BXAYEZZKYZYNIH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|