About N-(1-adamantylmethyl)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide
N-(1-adamantylmethyl)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 51085915) has the molecular formula C16H23N5O3
and a molecular weight of 333.39 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(1-adamantylmethyl)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| PubChem CID | 51085915 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | N-(1-adamantylmethyl)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | CN(CC12CC3CC(CC(C3)C1)C2)C(=O)Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C16H23N5O3/c1-19(14(22)8-20-10-17-15(18-20)21(23)24)9-16-5-11-2-12(6-16)4-13(3-11)7-16/h10-13H,2-9H2,1H3 |
| InChIKey | JYKKQUULMQHXCB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1-adamantylmethyl)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-adamantylmethyl)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide?
The IUPAC name of N-(1-adamantylmethyl)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (CID 51085915) is N-(1-adamantylmethyl)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
What is the SMILES notation for N-(1-adamantylmethyl)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide?
The canonical SMILES for N-(1-adamantylmethyl)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide is CN(CC12CC3CC(CC(C3)C1)C2)C(=O)Cn1cnc([N+](=O)[O-])n1.
What is the InChIKey of N-(1-adamantylmethyl)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide?
The InChIKey is JYKKQUULMQHXCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5O3/c1-19(14(22)8-20-10-17-15(18-20)21(23)24)9-16-5-11-2-12(6-16)4-13(3-11)7-16/h10-13H,2-9H2,1H3.
What are the key properties of N-(1-adamantylmethyl)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide?
N-(1-adamantylmethyl)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide has a molecular weight of 333.39 g/mol, XLogP of 1.86, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-adamantylmethyl)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide is sourced from PubChem (CID 51085915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).