About N-benzylsulfonyl-2,4-difluorobenzamide
N-benzylsulfonyl-2,4-difluorobenzamide (PubChem CID 51086094) has the molecular formula C14H11F2NO3S
and a molecular weight of 311.31 g/mol. Its IUPAC name is N-benzylsulfonyl-2,4-difluorobenzamide.
Molecular Properties
| Compound Name | N-benzylsulfonyl-2,4-difluorobenzamide |
| PubChem CID | 51086094 |
| Molecular Formula | C14H11F2NO3S |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-benzylsulfonyl-2,4-difluorobenzamide |
| SMILES | O=C(NS(=O)(=O)Cc1ccccc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H11F2NO3S/c15-11-6-7-12(13(16)8-11)14(18)17-21(19,20)9-10-4-2-1-3-5-10/h1-8H,9H2,(H,17,18) |
| InChIKey | MWDHALIHODJETQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzylsulfonyl-2,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylsulfonyl-2,4-difluorobenzamide?
The IUPAC name of N-benzylsulfonyl-2,4-difluorobenzamide (CID 51086094) is N-benzylsulfonyl-2,4-difluorobenzamide.
What is the SMILES notation for N-benzylsulfonyl-2,4-difluorobenzamide?
The canonical SMILES for N-benzylsulfonyl-2,4-difluorobenzamide is O=C(NS(=O)(=O)Cc1ccccc1)c1ccc(F)cc1F.
What is the InChIKey of N-benzylsulfonyl-2,4-difluorobenzamide?
The InChIKey is MWDHALIHODJETQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F2NO3S/c15-11-6-7-12(13(16)8-11)14(18)17-21(19,20)9-10-4-2-1-3-5-10/h1-8H,9H2,(H,17,18).
What are the key properties of N-benzylsulfonyl-2,4-difluorobenzamide?
N-benzylsulfonyl-2,4-difluorobenzamide has a molecular weight of 311.31 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylsulfonyl-2,4-difluorobenzamide is sourced from PubChem (CID 51086094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).