About 2,4-dioxo-5,5-diphenylpentanoic acid
2,4-dioxo-5,5-diphenylpentanoic acid (PubChem CID 510864) has the molecular formula C17H14O4
and a molecular weight of 282.30 g/mol. Its IUPAC name is 2,4-dioxo-5,5-diphenylpentanoic acid.
Molecular Properties
| Compound Name | 2,4-dioxo-5,5-diphenylpentanoic acid |
| PubChem CID | 510864 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2,4-dioxo-5,5-diphenylpentanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H14O4/c18-14(11-15(19)17(20)21)16(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,16H,11H2,(H,20,21) |
| InChIKey | JOCHGVOUYRAZGQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dioxo-5,5-diphenylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dioxo-5,5-diphenylpentanoic acid?
The IUPAC name of 2,4-dioxo-5,5-diphenylpentanoic acid (CID 510864) is 2,4-dioxo-5,5-diphenylpentanoic acid.
What is the SMILES notation for 2,4-dioxo-5,5-diphenylpentanoic acid?
The canonical SMILES for 2,4-dioxo-5,5-diphenylpentanoic acid is O=C(O)C(=O)CC(=O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of 2,4-dioxo-5,5-diphenylpentanoic acid?
The InChIKey is JOCHGVOUYRAZGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O4/c18-14(11-15(19)17(20)21)16(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,16H,11H2,(H,20,21).
What are the key properties of 2,4-dioxo-5,5-diphenylpentanoic acid?
2,4-dioxo-5,5-diphenylpentanoic acid has a molecular weight of 282.30 g/mol, XLogP of 2.43, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dioxo-5,5-diphenylpentanoic acid is sourced from PubChem (CID 510864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).