About 4-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine
4-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine (PubChem CID 51086508) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is 4-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine.
Molecular Properties
| Compound Name | 4-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine |
| PubChem CID | 51086508 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine |
| SMILES | CC(C)c1nc(CN2CCOCC2)cs1 |
| InChI | InChI=1S/C11H18N2OS/c1-9(2)11-12-10(8-15-11)7-13-3-5-14-6-4-13/h8-9H,3-7H2,1-2H3 |
| InChIKey | NQPPENHEGDFETI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine?
The IUPAC name of 4-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine (CID 51086508) is 4-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine.
What is the SMILES notation for 4-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine?
The canonical SMILES for 4-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine is CC(C)c1nc(CN2CCOCC2)cs1.
What is the InChIKey of 4-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine?
The InChIKey is NQPPENHEGDFETI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2OS/c1-9(2)11-12-10(8-15-11)7-13-3-5-14-6-4-13/h8-9H,3-7H2,1-2H3.
What are the key properties of 4-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine?
4-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine has a molecular weight of 226.34 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine is sourced from PubChem (CID 51086508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).