About 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-dimethylmorpholine
4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-dimethylmorpholine (PubChem CID 51086777) has the molecular formula C11H18N4O3
and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-dimethylmorpholine |
| PubChem CID | 51086777 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-dimethylmorpholine |
| SMILES | Cc1nn(C)c(N2CCOC(C)(C)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H18N4O3/c1-8-9(15(16)17)10(13(4)12-8)14-5-6-18-11(2,3)7-14/h5-7H2,1-4H3 |
| InChIKey | DMJLVGOCKSQYPP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-dimethylmorpholine?
The IUPAC name of 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-dimethylmorpholine (CID 51086777) is 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-dimethylmorpholine.
What is the SMILES notation for 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-dimethylmorpholine?
The canonical SMILES for 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-dimethylmorpholine is Cc1nn(C)c(N2CCOC(C)(C)C2)c1[N+](=O)[O-].
What is the InChIKey of 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-dimethylmorpholine?
The InChIKey is DMJLVGOCKSQYPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O3/c1-8-9(15(16)17)10(13(4)12-8)14-5-6-18-11(2,3)7-14/h5-7H2,1-4H3.
What are the key properties of 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-dimethylmorpholine?
4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-dimethylmorpholine has a molecular weight of 254.29 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-dimethylmorpholine is sourced from PubChem (CID 51086777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).