About morpholine-2,3-dione
morpholine-2,3-dione (PubChem CID 5108689) has the molecular formula C4H5NO3
and a molecular weight of 115.09 g/mol. Its IUPAC name is morpholine-2,3-dione.
Molecular Properties
| Compound Name | morpholine-2,3-dione |
| PubChem CID | 5108689 |
| Molecular Formula | C4H5NO3 |
| Molecular Weight | 115.09 g/mol |
| Exact Mass | 115.03 |
| IUPAC Name | morpholine-2,3-dione |
| SMILES | O=C1NCCOC1=O |
| InChI | InChI=1S/C4H5NO3/c6-3-4(7)8-2-1-5-3/h1-2H2,(H,5,6) |
| InChIKey | MENOBBYDZHOWLE-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.09 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze morpholine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine-2,3-dione?
The IUPAC name of morpholine-2,3-dione (CID 5108689) is morpholine-2,3-dione.
What is the SMILES notation for morpholine-2,3-dione?
The canonical SMILES for morpholine-2,3-dione is O=C1NCCOC1=O.
What is the InChIKey of morpholine-2,3-dione?
The InChIKey is MENOBBYDZHOWLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3/c6-3-4(7)8-2-1-5-3/h1-2H2,(H,5,6).
What are the key properties of morpholine-2,3-dione?
morpholine-2,3-dione has a molecular weight of 115.09 g/mol, XLogP of -1.34, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine-2,3-dione is sourced from PubChem (CID 5108689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).