C18H22N4O3 — CID 51087082
3,6,6-trimethyl-4-oxo-N-[2-(pyrimidin-2-ylamino)ethyl]-5,7-dihydro-1-benzofuran-2-carboxamide (PubChem CID 51087082) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 3,6,6-trimethyl-4-oxo-N-[2-(pyrimidin-2-ylamino)ethyl]-5,7-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | 3,6,6-trimethyl-4-oxo-N-[2-(pyrimidin-2-ylamino)ethyl]-5,7-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 51087082 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 3,6,6-trimethyl-4-oxo-N-[2-(pyrimidin-2-ylamino)ethyl]-5,7-dihydro-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCNc2ncccn2)oc2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C18H22N4O3/c1-11-14-12(23)9-18(2,3)10-13(14)25-15(11)16(24)19-7-8-22-17-20-5-4-6-21-17/h4-6H,7-10H2,1-3H3,(H,19,24)(H,20,21,22) |
| InChIKey | VHJQOXPGUJJYMJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|