C17H21F2NO2S — CID 51087401
1-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-3-ethylsulfanylpropan-1-one (PubChem CID 51087401) has the molecular formula C17H21F2NO2S and a molecular weight of 341.42 g/mol. Its IUPAC name is 1-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-3-ethylsulfanylpropan-1-one.
| Compound Name | 1-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-3-ethylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 51087401 |
| Molecular Formula | C17H21F2NO2S |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-3-ethylsulfanylpropan-1-one |
| SMILES | CCSCCC(=O)N1CCC(C(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C17H21F2NO2S/c1-2-23-10-7-16(21)20-8-5-12(6-9-20)17(22)14-11-13(18)3-4-15(14)19/h3-4,11-12H,2,5-10H2,1H3 |
| InChIKey | XEMMSSGIELUJMH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|