C15H18N2O4S — CID 51087705
3-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)propyl]imidazolidine-2,4-dione (PubChem CID 51087705) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 3-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)propyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51087705 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)propyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCCSc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C15H18N2O4S/c18-14-10-16-15(19)17(14)5-1-8-22-11-3-4-12-13(9-11)21-7-2-6-20-12/h3-4,9H,1-2,5-8,10H2,(H,16,19) |
| InChIKey | BNOPTHWWGNLFIA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|