C15H23N3O3 — CID 51088000
methyl N-[2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl]carbamate (PubChem CID 51088000) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is methyl N-[2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl]carbamate.
| Compound Name | methyl N-[2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 51088000 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | methyl N-[2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl]carbamate |
| SMILES | CCN(c1ccc(NC(=O)CNC(=O)OC)cc1)C(C)C |
| InChI | InChI=1S/C15H23N3O3/c1-5-18(11(2)3)13-8-6-12(7-9-13)17-14(19)10-16-15(20)21-4/h6-9,11H,5,10H2,1-4H3,(H,16,20)(H,17,19) |
| InChIKey | ACXIRFFGISDIEU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |