C21H19N3OS2 — CID 5108813
6-[(2,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 5108813) has the molecular formula C21H19N3OS2 and a molecular weight of 393.54 g/mol. Its IUPAC name is 6-[(2,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 6-[(2,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5108813 |
| Molecular Formula | C21H19N3OS2 |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 6-[(2,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | Cc1ccc(C)c(Cn2c(C)nc3c(sc(=S)n3-c3ccccc3)c2=O)c1 |
| InChI | InChI=1S/C21H19N3OS2/c1-13-9-10-14(2)16(11-13)12-23-15(3)22-19-18(20(23)25)27-21(26)24(19)17-7-5-4-6-8-17/h4-11H,12H2,1-3H3 |
| InChIKey | LRHGNGIZUOPKBZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|