C18H19FN4O2 — CID 51089109
3-(3-fluorophenyl)-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 51089109) has the molecular formula C18H19FN4O2 and a molecular weight of 342.37 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(3-fluorophenyl)-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 51089109 |
| Molecular Formula | C18H19FN4O2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 3-(3-fluorophenyl)-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | Cn1ncc2c1CCCC2NC(=O)C1CC(c2cccc(F)c2)=NO1 |
| InChI | InChI=1S/C18H19FN4O2/c1-23-16-7-3-6-14(13(16)10-20-23)21-18(24)17-9-15(22-25-17)11-4-2-5-12(19)8-11/h2,4-5,8,10,14,17H,3,6-7,9H2,1H3,(H,21,24) |
| InChIKey | DAYZJXKZJCCEQO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |