C17H17ClN4O — CID 51090240
3-chloro-N-cyclopropyl-N-[(1-methylimidazol-2-yl)methyl]-1H-indole-2-carboxamide (PubChem CID 51090240) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is 3-chloro-N-cyclopropyl-N-[(1-methylimidazol-2-yl)methyl]-1H-indole-2-carboxamide.
| Compound Name | 3-chloro-N-cyclopropyl-N-[(1-methylimidazol-2-yl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 51090240 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 3-chloro-N-cyclopropyl-N-[(1-methylimidazol-2-yl)methyl]-1H-indole-2-carboxamide |
| SMILES | Cn1ccnc1CN(C(=O)c1[nH]c2ccccc2c1Cl)C1CC1 |
| InChI | InChI=1S/C17H17ClN4O/c1-21-9-8-19-14(21)10-22(11-6-7-11)17(23)16-15(18)12-4-2-3-5-13(12)20-16/h2-5,8-9,11,20H,6-7,10H2,1H3 |
| InChIKey | AWQRSAFGEQGKPF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |