C14H23N5O2 — CID 51091035
2-[[1-(2-amino-2-oxoethyl)pyrazol-3-yl]amino]-N-cycloheptylacetamide (PubChem CID 51091035) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-[[1-(2-amino-2-oxoethyl)pyrazol-3-yl]amino]-N-cycloheptylacetamide.
| Compound Name | 2-[[1-(2-amino-2-oxoethyl)pyrazol-3-yl]amino]-N-cycloheptylacetamide |
|---|---|
| PubChem CID | 51091035 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 2-[[1-(2-amino-2-oxoethyl)pyrazol-3-yl]amino]-N-cycloheptylacetamide |
| SMILES | NC(=O)Cn1ccc(NCC(=O)NC2CCCCCC2)n1 |
| InChI | InChI=1S/C14H23N5O2/c15-12(20)10-19-8-7-13(18-19)16-9-14(21)17-11-5-3-1-2-4-6-11/h7-8,11H,1-6,9-10H2,(H2,15,20)(H,16,18)(H,17,21) |
| InChIKey | YRHWVPRZWBGNMF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |