C15H16N8O — CID 51091827
N-[3-(pyrimidin-2-ylamino)propyl]-2-(1,2,4-triazol-1-yl)pyridine-4-carboxamide (PubChem CID 51091827) has the molecular formula C15H16N8O and a molecular weight of 324.35 g/mol. Its IUPAC name is N-[3-(pyrimidin-2-ylamino)propyl]-2-(1,2,4-triazol-1-yl)pyridine-4-carboxamide.
| Compound Name | N-[3-(pyrimidin-2-ylamino)propyl]-2-(1,2,4-triazol-1-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 51091827 |
| Molecular Formula | C15H16N8O |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | N-[3-(pyrimidin-2-ylamino)propyl]-2-(1,2,4-triazol-1-yl)pyridine-4-carboxamide |
| SMILES | O=C(NCCCNc1ncccn1)c1ccnc(-n2cncn2)c1 |
| InChI | InChI=1S/C15H16N8O/c24-14(18-4-1-5-19-15-20-6-2-7-21-15)12-3-8-17-13(9-12)23-11-16-10-22-23/h2-3,6-11H,1,4-5H2,(H,18,24)(H,19,20,21) |
| InChIKey | WHOXEIUWACXLJG-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|