C16H11N3O3S — CID 51091865
2-imidazo[2,1-b][1,3]thiazol-6-yl-N-(2-oxochromen-6-yl)acetamide (PubChem CID 51091865) has the molecular formula C16H11N3O3S and a molecular weight of 325.35 g/mol. Its IUPAC name is 2-imidazo[2,1-b][1,3]thiazol-6-yl-N-(2-oxochromen-6-yl)acetamide.
| Compound Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-N-(2-oxochromen-6-yl)acetamide |
|---|---|
| PubChem CID | 51091865 |
| Molecular Formula | C16H11N3O3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-N-(2-oxochromen-6-yl)acetamide |
| SMILES | O=C(Cc1cn2ccsc2n1)Nc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C16H11N3O3S/c20-14(8-12-9-19-5-6-23-16(19)18-12)17-11-2-3-13-10(7-11)1-4-15(21)22-13/h1-7,9H,8H2,(H,17,20) |
| InChIKey | GPVBLMONPAZESS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|