C13H17N5O2S2 — CID 51093810
N-[4-methyl-5-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-2-prop-2-enoxypropanamide (PubChem CID 51093810) has the molecular formula C13H17N5O2S2 and a molecular weight of 339.45 g/mol. Its IUPAC name is N-[4-methyl-5-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-2-prop-2-enoxypropanamide.
| Compound Name | N-[4-methyl-5-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-2-prop-2-enoxypropanamide |
|---|---|
| PubChem CID | 51093810 |
| Molecular Formula | C13H17N5O2S2 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-[4-methyl-5-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-2-prop-2-enoxypropanamide |
| SMILES | C=CCOC(C)C(=O)Nc1nc(C)c(-c2n[nH]c(=S)n2C)s1 |
| InChI | InChI=1S/C13H17N5O2S2/c1-5-6-20-8(3)11(19)15-12-14-7(2)9(22-12)10-16-17-13(21)18(10)4/h5,8H,1,6H2,2-4H3,(H,17,21)(H,14,15,19) |
| InChIKey | YYGQTTSPIMDGEM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|