C18H21N3O4 — CID 51094032
8-(3-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 51094032) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 8-(3-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(3-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 51094032 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 8-(3-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(C(=O)c3cc4c(cc3O)CCCC4)CC2)N1 |
| InChI | InChI=1S/C18H21N3O4/c22-14-10-12-4-2-1-3-11(12)9-13(14)15(23)21-7-5-18(6-8-21)16(24)19-17(25)20-18/h9-10,22H,1-8H2,(H2,19,20,24,25) |
| InChIKey | PZHHQQUNQNNYCI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|