C17H18ClN3OS — CID 51094732
(E)-N-[[1-(4-chlorophenyl)pyrrolidin-3-yl]methyl]-3-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 51094732) has the molecular formula C17H18ClN3OS and a molecular weight of 347.87 g/mol. Its IUPAC name is (E)-N-[[1-(4-chlorophenyl)pyrrolidin-3-yl]methyl]-3-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[[1-(4-chlorophenyl)pyrrolidin-3-yl]methyl]-3-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 51094732 |
| Molecular Formula | C17H18ClN3OS |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (E)-N-[[1-(4-chlorophenyl)pyrrolidin-3-yl]methyl]-3-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1nccs1)NCC1CCN(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H18ClN3OS/c18-14-1-3-15(4-2-14)21-9-7-13(12-21)11-20-16(22)5-6-17-19-8-10-23-17/h1-6,8,10,13H,7,9,11-12H2,(H,20,22)/b6-5+ |
| InChIKey | ICNVQPOKXWEECQ-AATRIKPKSA-N |
| XLogP | 3.45 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|