C12H16F6N2O2 — CID 51095171
1-N,3-N-bis(2,2,2-trifluoroethyl)cyclohexane-1,3-dicarboxamide (PubChem CID 51095171) has the molecular formula C12H16F6N2O2 and a molecular weight of 334.26 g/mol. Its IUPAC name is 1-N,3-N-bis(2,2,2-trifluoroethyl)cyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2,2,2-trifluoroethyl)cyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 51095171 |
| Molecular Formula | C12H16F6N2O2 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-N,3-N-bis(2,2,2-trifluoroethyl)cyclohexane-1,3-dicarboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CCCC(C(=O)NCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H16F6N2O2/c13-11(14,15)5-19-9(21)7-2-1-3-8(4-7)10(22)20-6-12(16,17)18/h7-8H,1-6H2,(H,19,21)(H,20,22) |
| InChIKey | BITYYOUVDOLMNN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |