About tert-butyl 2-[(5-methyl-1,2-oxazol-3-yl)methylcarbamoyl]piperidine-1-carboxylate
tert-butyl 2-[(5-methyl-1,2-oxazol-3-yl)methylcarbamoyl]piperidine-1-carboxylate (PubChem CID 51095599) has the molecular formula C16H25N3O4
and a molecular weight of 323.39 g/mol. Its IUPAC name is tert-butyl 2-[(5-methyl-1,2-oxazol-3-yl)methylcarbamoyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-[(5-methyl-1,2-oxazol-3-yl)methylcarbamoyl]piperidine-1-carboxylate |
| PubChem CID | 51095599 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | tert-butyl 2-[(5-methyl-1,2-oxazol-3-yl)methylcarbamoyl]piperidine-1-carboxylate |
| SMILES | Cc1cc(CNC(=O)C2CCCCN2C(=O)OC(C)(C)C)no1 |
| InChI | InChI=1S/C16H25N3O4/c1-11-9-12(18-23-11)10-17-14(20)13-7-5-6-8-19(13)15(21)22-16(2,3)4/h9,13H,5-8,10H2,1-4H3,(H,17,20) |
| InChIKey | XNZZONNWHWMWLJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-[(5-methyl-1,2-oxazol-3-yl)methylcarbamoyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(5-methyl-1,2-oxazol-3-yl)methylcarbamoyl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 2-[(5-methyl-1,2-oxazol-3-yl)methylcarbamoyl]piperidine-1-carboxylate (CID 51095599) is tert-butyl 2-[(5-methyl-1,2-oxazol-3-yl)methylcarbamoyl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 2-[(5-methyl-1,2-oxazol-3-yl)methylcarbamoyl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 2-[(5-methyl-1,2-oxazol-3-yl)methylcarbamoyl]piperidine-1-carboxylate is Cc1cc(CNC(=O)C2CCCCN2C(=O)OC(C)(C)C)no1.
What is the InChIKey of tert-butyl 2-[(5-methyl-1,2-oxazol-3-yl)methylcarbamoyl]piperidine-1-carboxylate?
The InChIKey is XNZZONNWHWMWLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O4/c1-11-9-12(18-23-11)10-17-14(20)13-7-5-6-8-19(13)15(21)22-16(2,3)4/h9,13H,5-8,10H2,1-4H3,(H,17,20).
What are the key properties of tert-butyl 2-[(5-methyl-1,2-oxazol-3-yl)methylcarbamoyl]piperidine-1-carboxylate?
tert-butyl 2-[(5-methyl-1,2-oxazol-3-yl)methylcarbamoyl]piperidine-1-carboxylate has a molecular weight of 323.39 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(5-methyl-1,2-oxazol-3-yl)methylcarbamoyl]piperidine-1-carboxylate is sourced from PubChem (CID 51095599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).