C10H7F9N2OS — CID 5109657
N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2,3,3,4,4,5,5,5-nonafluoropentanamide (PubChem CID 5109657) has the molecular formula C10H7F9N2OS and a molecular weight of 374.23 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2,3,3,4,4,5,5,5-nonafluoropentanamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
|---|---|
| PubChem CID | 5109657 |
| Molecular Formula | C10H7F9N2OS |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
| SMILES | Cc1nc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)sc1C |
| InChI | InChI=1S/C10H7F9N2OS/c1-3-4(2)23-6(20-3)21-5(22)7(11,12)8(13,14)9(15,16)10(17,18)19/h1-2H3,(H,20,21,22) |
| InChIKey | OKJRQCIQAMBNLX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|