C17H17F2NO3 — CID 51097366
2-(3,4-difluorophenoxy)-N-(2-hydroxy-2-phenylethyl)propanamide (PubChem CID 51097366) has the molecular formula C17H17F2NO3 and a molecular weight of 321.32 g/mol. Its IUPAC name is 2-(3,4-difluorophenoxy)-N-(2-hydroxy-2-phenylethyl)propanamide.
| Compound Name | 2-(3,4-difluorophenoxy)-N-(2-hydroxy-2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 51097366 |
| Molecular Formula | C17H17F2NO3 |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-(3,4-difluorophenoxy)-N-(2-hydroxy-2-phenylethyl)propanamide |
| SMILES | CC(Oc1ccc(F)c(F)c1)C(=O)NCC(O)c1ccccc1 |
| InChI | InChI=1S/C17H17F2NO3/c1-11(23-13-7-8-14(18)15(19)9-13)17(22)20-10-16(21)12-5-3-2-4-6-12/h2-9,11,16,21H,10H2,1H3,(H,20,22) |
| InChIKey | AZTLNVSILIJKAX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |