About N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-3,5-dimethylbenzamide
N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-3,5-dimethylbenzamide (PubChem CID 51097547) has the molecular formula C17H26N2O2
and a molecular weight of 290.41 g/mol. Its IUPAC name is N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-3,5-dimethylbenzamide.
Molecular Properties
| Compound Name | N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-3,5-dimethylbenzamide |
| PubChem CID | 51097547 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-3,5-dimethylbenzamide |
| SMILES | COCCN1CCC(CNC(=O)c2cc(C)cc(C)c2)C1 |
| InChI | InChI=1S/C17H26N2O2/c1-13-8-14(2)10-16(9-13)17(20)18-11-15-4-5-19(12-15)6-7-21-3/h8-10,15H,4-7,11-12H2,1-3H3,(H,18,20) |
| InChIKey | IHFPLAFXRMQQKJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-3,5-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-3,5-dimethylbenzamide?
The IUPAC name of N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-3,5-dimethylbenzamide (CID 51097547) is N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-3,5-dimethylbenzamide.
What is the SMILES notation for N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-3,5-dimethylbenzamide?
The canonical SMILES for N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-3,5-dimethylbenzamide is COCCN1CCC(CNC(=O)c2cc(C)cc(C)c2)C1.
What is the InChIKey of N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-3,5-dimethylbenzamide?
The InChIKey is IHFPLAFXRMQQKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2/c1-13-8-14(2)10-16(9-13)17(20)18-11-15-4-5-19(12-15)6-7-21-3/h8-10,15H,4-7,11-12H2,1-3H3,(H,18,20).
What are the key properties of N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-3,5-dimethylbenzamide?
N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-3,5-dimethylbenzamide has a molecular weight of 290.41 g/mol, XLogP of 2.00, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-3,5-dimethylbenzamide is sourced from PubChem (CID 51097547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).