About 4-[(1-ethylsulfonylpiperidin-4-yl)amino]-3,5-difluorobenzonitrile
4-[(1-ethylsulfonylpiperidin-4-yl)amino]-3,5-difluorobenzonitrile (PubChem CID 51098326) has the molecular formula C14H17F2N3O2S
and a molecular weight of 329.37 g/mol. Its IUPAC name is 4-[(1-ethylsulfonylpiperidin-4-yl)amino]-3,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[(1-ethylsulfonylpiperidin-4-yl)amino]-3,5-difluorobenzonitrile |
| PubChem CID | 51098326 |
| Molecular Formula | C14H17F2N3O2S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 4-[(1-ethylsulfonylpiperidin-4-yl)amino]-3,5-difluorobenzonitrile |
| SMILES | CCS(=O)(=O)N1CCC(Nc2c(F)cc(C#N)cc2F)CC1 |
| InChI | InChI=1S/C14H17F2N3O2S/c1-2-22(20,21)19-5-3-11(4-6-19)18-14-12(15)7-10(9-17)8-13(14)16/h7-8,11,18H,2-6H2,1H3 |
| InChIKey | DNKFRFAJYBYUSF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(1-ethylsulfonylpiperidin-4-yl)amino]-3,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-ethylsulfonylpiperidin-4-yl)amino]-3,5-difluorobenzonitrile?
The IUPAC name of 4-[(1-ethylsulfonylpiperidin-4-yl)amino]-3,5-difluorobenzonitrile (CID 51098326) is 4-[(1-ethylsulfonylpiperidin-4-yl)amino]-3,5-difluorobenzonitrile.
What is the SMILES notation for 4-[(1-ethylsulfonylpiperidin-4-yl)amino]-3,5-difluorobenzonitrile?
The canonical SMILES for 4-[(1-ethylsulfonylpiperidin-4-yl)amino]-3,5-difluorobenzonitrile is CCS(=O)(=O)N1CCC(Nc2c(F)cc(C#N)cc2F)CC1.
What is the InChIKey of 4-[(1-ethylsulfonylpiperidin-4-yl)amino]-3,5-difluorobenzonitrile?
The InChIKey is DNKFRFAJYBYUSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2N3O2S/c1-2-22(20,21)19-5-3-11(4-6-19)18-14-12(15)7-10(9-17)8-13(14)16/h7-8,11,18H,2-6H2,1H3.
What are the key properties of 4-[(1-ethylsulfonylpiperidin-4-yl)amino]-3,5-difluorobenzonitrile?
4-[(1-ethylsulfonylpiperidin-4-yl)amino]-3,5-difluorobenzonitrile has a molecular weight of 329.37 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-ethylsulfonylpiperidin-4-yl)amino]-3,5-difluorobenzonitrile is sourced from PubChem (CID 51098326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).