About [3-methyl-4-[(3-propyl-1,2,4-oxadiazol-5-yl)methylamino]phenyl]-pyrrolidin-1-ylmethanone
[3-methyl-4-[(3-propyl-1,2,4-oxadiazol-5-yl)methylamino]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 51100846) has the molecular formula C18H24N4O2
and a molecular weight of 328.42 g/mol. Its IUPAC name is [3-methyl-4-[(3-propyl-1,2,4-oxadiazol-5-yl)methylamino]phenyl]-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | [3-methyl-4-[(3-propyl-1,2,4-oxadiazol-5-yl)methylamino]phenyl]-pyrrolidin-1-ylmethanone |
| PubChem CID | 51100846 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [3-methyl-4-[(3-propyl-1,2,4-oxadiazol-5-yl)methylamino]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | CCCc1noc(CNc2ccc(C(=O)N3CCCC3)cc2C)n1 |
| InChI | InChI=1S/C18H24N4O2/c1-3-6-16-20-17(24-21-16)12-19-15-8-7-14(11-13(15)2)18(23)22-9-4-5-10-22/h7-8,11,19H,3-6,9-10,12H2,1-2H3 |
| InChIKey | BSGOBFOMDMHQRI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-methyl-4-[(3-propyl-1,2,4-oxadiazol-5-yl)methylamino]phenyl]-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-4-[(3-propyl-1,2,4-oxadiazol-5-yl)methylamino]phenyl]-pyrrolidin-1-ylmethanone?
The IUPAC name of [3-methyl-4-[(3-propyl-1,2,4-oxadiazol-5-yl)methylamino]phenyl]-pyrrolidin-1-ylmethanone (CID 51100846) is [3-methyl-4-[(3-propyl-1,2,4-oxadiazol-5-yl)methylamino]phenyl]-pyrrolidin-1-ylmethanone.
What is the SMILES notation for [3-methyl-4-[(3-propyl-1,2,4-oxadiazol-5-yl)methylamino]phenyl]-pyrrolidin-1-ylmethanone?
The canonical SMILES for [3-methyl-4-[(3-propyl-1,2,4-oxadiazol-5-yl)methylamino]phenyl]-pyrrolidin-1-ylmethanone is CCCc1noc(CNc2ccc(C(=O)N3CCCC3)cc2C)n1.
What is the InChIKey of [3-methyl-4-[(3-propyl-1,2,4-oxadiazol-5-yl)methylamino]phenyl]-pyrrolidin-1-ylmethanone?
The InChIKey is BSGOBFOMDMHQRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O2/c1-3-6-16-20-17(24-21-16)12-19-15-8-7-14(11-13(15)2)18(23)22-9-4-5-10-22/h7-8,11,19H,3-6,9-10,12H2,1-2H3.
What are the key properties of [3-methyl-4-[(3-propyl-1,2,4-oxadiazol-5-yl)methylamino]phenyl]-pyrrolidin-1-ylmethanone?
[3-methyl-4-[(3-propyl-1,2,4-oxadiazol-5-yl)methylamino]phenyl]-pyrrolidin-1-ylmethanone has a molecular weight of 328.42 g/mol, XLogP of 3.18, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-4-[(3-propyl-1,2,4-oxadiazol-5-yl)methylamino]phenyl]-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 51100846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).