C16H17N3O4S — CID 51100882
2-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-N-prop-2-ynylacetamide (PubChem CID 51100882) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is 2-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-N-prop-2-ynylacetamide.
| Compound Name | 2-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 51100882 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CSCc1nc(-c2ccc(OC)cc2OC)no1 |
| InChI | InChI=1S/C16H17N3O4S/c1-4-7-17-14(20)9-24-10-15-18-16(19-23-15)12-6-5-11(21-2)8-13(12)22-3/h1,5-6,8H,7,9-10H2,2-3H3,(H,17,20) |
| InChIKey | NVMLGOZWHBZHNE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|