C13H11N3O4S — CID 51101089
2-(4-nitrophenyl)sulfanyl-N-(2-oxo-1H-pyridin-3-yl)acetamide (PubChem CID 51101089) has the molecular formula C13H11N3O4S and a molecular weight of 305.31 g/mol. Its IUPAC name is 2-(4-nitrophenyl)sulfanyl-N-(2-oxo-1H-pyridin-3-yl)acetamide.
| Compound Name | 2-(4-nitrophenyl)sulfanyl-N-(2-oxo-1H-pyridin-3-yl)acetamide |
|---|---|
| PubChem CID | 51101089 |
| Molecular Formula | C13H11N3O4S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-(4-nitrophenyl)sulfanyl-N-(2-oxo-1H-pyridin-3-yl)acetamide |
| SMILES | O=C(CSc1ccc([N+](=O)[O-])cc1)Nc1ccc[nH]c1=O |
| InChI | InChI=1S/C13H11N3O4S/c17-12(15-11-2-1-7-14-13(11)18)8-21-10-5-3-9(4-6-10)16(19)20/h1-7H,8H2,(H,14,18)(H,15,17) |
| InChIKey | BSYMVGPLZFADMO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 105.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|