C12H16O4 — CID 5110150
2,5-dihydroxy-3,6-dipropylcyclohexa-2,5-diene-1,4-dione (PubChem CID 5110150) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2,5-dihydroxy-3,6-dipropylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dihydroxy-3,6-dipropylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 5110150 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2,5-dihydroxy-3,6-dipropylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCC1=C(O)C(=O)C(CCC)=C(O)C1=O |
| InChI | InChI=1S/C12H16O4/c1-3-5-7-9(13)11(15)8(6-4-2)12(16)10(7)14/h13,16H,3-6H2,1-2H3 |
| InChIKey | YCLCPWKMFMPFNO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|