C17H14F2N4O2 — CID 51101844
N-[2-[(2,4-difluorobenzoyl)amino]ethyl]-1H-indazole-4-carboxamide (PubChem CID 51101844) has the molecular formula C17H14F2N4O2 and a molecular weight of 344.32 g/mol. Its IUPAC name is N-[2-[(2,4-difluorobenzoyl)amino]ethyl]-1H-indazole-4-carboxamide.
| Compound Name | N-[2-[(2,4-difluorobenzoyl)amino]ethyl]-1H-indazole-4-carboxamide |
|---|---|
| PubChem CID | 51101844 |
| Molecular Formula | C17H14F2N4O2 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-[2-[(2,4-difluorobenzoyl)amino]ethyl]-1H-indazole-4-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cccc2[nH]ncc12)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H14F2N4O2/c18-10-4-5-12(14(19)8-10)17(25)21-7-6-20-16(24)11-2-1-3-15-13(11)9-22-23-15/h1-5,8-9H,6-7H2,(H,20,24)(H,21,25)(H,22,23) |
| InChIKey | PTLYXBMSRAZRRF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|