About tert-butyl N-[[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]carbamate
tert-butyl N-[[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]carbamate (PubChem CID 51102006) has the molecular formula C18H27N5O2
and a molecular weight of 345.45 g/mol. Its IUPAC name is tert-butyl N-[[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]carbamate |
| PubChem CID | 51102006 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | tert-butyl N-[[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]carbamate |
| SMILES | Cc1nnc(N2CCC(CNC(=O)OC(C)(C)C)CC2)c(C#N)c1C |
| InChI | InChI=1S/C18H27N5O2/c1-12-13(2)21-22-16(15(12)10-19)23-8-6-14(7-9-23)11-20-17(24)25-18(3,4)5/h14H,6-9,11H2,1-5H3,(H,20,24) |
| InChIKey | BAZXXEGWPGBSSF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]carbamate?
The IUPAC name of tert-butyl N-[[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]carbamate (CID 51102006) is tert-butyl N-[[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]carbamate.
What is the SMILES notation for tert-butyl N-[[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]carbamate?
The canonical SMILES for tert-butyl N-[[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]carbamate is Cc1nnc(N2CCC(CNC(=O)OC(C)(C)C)CC2)c(C#N)c1C.
What is the InChIKey of tert-butyl N-[[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]carbamate?
The InChIKey is BAZXXEGWPGBSSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N5O2/c1-12-13(2)21-22-16(15(12)10-19)23-8-6-14(7-9-23)11-20-17(24)25-18(3,4)5/h14H,6-9,11H2,1-5H3,(H,20,24).
What are the key properties of tert-butyl N-[[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]carbamate?
tert-butyl N-[[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]carbamate has a molecular weight of 345.45 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]carbamate is sourced from PubChem (CID 51102006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).