C14H12N4OS — CID 51102512
N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]pyridine-3-carboxamide (PubChem CID 51102512) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]pyridine-3-carboxamide.
| Compound Name | N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 51102512 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(-c2cc(NC(=O)c3cccnc3)n[nH]2)s1 |
| InChI | InChI=1S/C14H12N4OS/c1-9-4-5-12(20-9)11-7-13(18-17-11)16-14(19)10-3-2-6-15-8-10/h2-8H,1H3,(H2,16,17,18,19) |
| InChIKey | HQBJZWJXTSQKJC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |