C13H10FN3O2 — CID 51102710
N-(4-fluoro-1H-indazol-3-yl)-3-methylfuran-2-carboxamide (PubChem CID 51102710) has the molecular formula C13H10FN3O2 and a molecular weight of 259.24 g/mol. Its IUPAC name is N-(4-fluoro-1H-indazol-3-yl)-3-methylfuran-2-carboxamide.
| Compound Name | N-(4-fluoro-1H-indazol-3-yl)-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 51102710 |
| Molecular Formula | C13H10FN3O2 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-(4-fluoro-1H-indazol-3-yl)-3-methylfuran-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)Nc1n[nH]c2cccc(F)c12 |
| InChI | InChI=1S/C13H10FN3O2/c1-7-5-6-19-11(7)13(18)15-12-10-8(14)3-2-4-9(10)16-17-12/h2-6H,1H3,(H2,15,16,17,18) |
| InChIKey | NHMGDESGCNABNH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |