C18H25N3O — CID 51103832
N-(3-phenylbutyl)-2-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 51103832) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is N-(3-phenylbutyl)-2-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | N-(3-phenylbutyl)-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 51103832 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | N-(3-phenylbutyl)-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | Cc1nn(C)c(C)c1CC(=O)NCCC(C)c1ccccc1 |
| InChI | InChI=1S/C18H25N3O/c1-13(16-8-6-5-7-9-16)10-11-19-18(22)12-17-14(2)20-21(4)15(17)3/h5-9,13H,10-12H2,1-4H3,(H,19,22) |
| InChIKey | ICLPUMVHUPYYDL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |