About 1-[4-(pyrazolo[1,5-a]pyrimidin-6-ylmethylamino)butyl]piperidine-4-carboxamide
1-[4-(pyrazolo[1,5-a]pyrimidin-6-ylmethylamino)butyl]piperidine-4-carboxamide (PubChem CID 51104036) has the molecular formula C17H26N6O
and a molecular weight of 330.44 g/mol. Its IUPAC name is 1-[4-(pyrazolo[1,5-a]pyrimidin-6-ylmethylamino)butyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[4-(pyrazolo[1,5-a]pyrimidin-6-ylmethylamino)butyl]piperidine-4-carboxamide |
| PubChem CID | 51104036 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 1-[4-(pyrazolo[1,5-a]pyrimidin-6-ylmethylamino)butyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CCCCNCc2cnc3ccnn3c2)CC1 |
| InChI | InChI=1S/C17H26N6O/c18-17(24)15-4-9-22(10-5-15)8-2-1-6-19-11-14-12-20-16-3-7-21-23(16)13-14/h3,7,12-13,15,19H,1-2,4-6,8-11H2,(H2,18,24) |
| InChIKey | ZCEQJGYUAWHELH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 88.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(pyrazolo[1,5-a]pyrimidin-6-ylmethylamino)butyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(pyrazolo[1,5-a]pyrimidin-6-ylmethylamino)butyl]piperidine-4-carboxamide?
The IUPAC name of 1-[4-(pyrazolo[1,5-a]pyrimidin-6-ylmethylamino)butyl]piperidine-4-carboxamide (CID 51104036) is 1-[4-(pyrazolo[1,5-a]pyrimidin-6-ylmethylamino)butyl]piperidine-4-carboxamide.
What is the SMILES notation for 1-[4-(pyrazolo[1,5-a]pyrimidin-6-ylmethylamino)butyl]piperidine-4-carboxamide?
The canonical SMILES for 1-[4-(pyrazolo[1,5-a]pyrimidin-6-ylmethylamino)butyl]piperidine-4-carboxamide is NC(=O)C1CCN(CCCCNCc2cnc3ccnn3c2)CC1.
What is the InChIKey of 1-[4-(pyrazolo[1,5-a]pyrimidin-6-ylmethylamino)butyl]piperidine-4-carboxamide?
The InChIKey is ZCEQJGYUAWHELH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N6O/c18-17(24)15-4-9-22(10-5-15)8-2-1-6-19-11-14-12-20-16-3-7-21-23(16)13-14/h3,7,12-13,15,19H,1-2,4-6,8-11H2,(H2,18,24).
What are the key properties of 1-[4-(pyrazolo[1,5-a]pyrimidin-6-ylmethylamino)butyl]piperidine-4-carboxamide?
1-[4-(pyrazolo[1,5-a]pyrimidin-6-ylmethylamino)butyl]piperidine-4-carboxamide has a molecular weight of 330.44 g/mol, XLogP of 0.80, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(pyrazolo[1,5-a]pyrimidin-6-ylmethylamino)butyl]piperidine-4-carboxamide is sourced from PubChem (CID 51104036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).