About N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine
N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine (PubChem CID 51104699) has the molecular formula C17H25N5O
and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine.
Molecular Properties
| Compound Name | N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine |
| PubChem CID | 51104699 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine |
| SMILES | Cc1nn(C)c(N2CCOCC2)c1CNC(C)c1ccccn1 |
| InChI | InChI=1S/C17H25N5O/c1-13-15(12-19-14(2)16-6-4-5-7-18-16)17(21(3)20-13)22-8-10-23-11-9-22/h4-7,14,19H,8-12H2,1-3H3 |
| InChIKey | DDGSUWYWKWCGMJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine?
The IUPAC name of N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine (CID 51104699) is N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine.
What is the SMILES notation for N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine?
The canonical SMILES for N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine is Cc1nn(C)c(N2CCOCC2)c1CNC(C)c1ccccn1.
What is the InChIKey of N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine?
The InChIKey is DDGSUWYWKWCGMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N5O/c1-13-15(12-19-14(2)16-6-4-5-7-18-16)17(21(3)20-13)22-8-10-23-11-9-22/h4-7,14,19H,8-12H2,1-3H3.
What are the key properties of N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine?
N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine has a molecular weight of 315.42 g/mol, XLogP of 1.81, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine is sourced from PubChem (CID 51104699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).