About 2-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]-1-phenylethanol
2-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]-1-phenylethanol (PubChem CID 51104710) has the molecular formula C16H24N4O
and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]-1-phenylethanol.
Molecular Properties
| Compound Name | 2-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]-1-phenylethanol |
| PubChem CID | 51104710 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 2-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]-1-phenylethanol |
| SMILES | Cc1nn(C)c(N(C)C)c1CNCC(O)c1ccccc1 |
| InChI | InChI=1S/C16H24N4O/c1-12-14(16(19(2)3)20(4)18-12)10-17-11-15(21)13-8-6-5-7-9-13/h5-9,15,17,21H,10-11H2,1-4H3 |
| InChIKey | TXCPWSFRUQWPHX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]-1-phenylethanol?
The IUPAC name of 2-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]-1-phenylethanol (CID 51104710) is 2-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]-1-phenylethanol.
What is the SMILES notation for 2-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]-1-phenylethanol?
The canonical SMILES for 2-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]-1-phenylethanol is Cc1nn(C)c(N(C)C)c1CNCC(O)c1ccccc1.
What is the InChIKey of 2-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]-1-phenylethanol?
The InChIKey is TXCPWSFRUQWPHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O/c1-12-14(16(19(2)3)20(4)18-12)10-17-11-15(21)13-8-6-5-7-9-13/h5-9,15,17,21H,10-11H2,1-4H3.
What are the key properties of 2-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]-1-phenylethanol?
2-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]-1-phenylethanol has a molecular weight of 288.39 g/mol, XLogP of 1.62, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]-1-phenylethanol is sourced from PubChem (CID 51104710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).