C14H27N5O3S — CID 51104850
N-[3-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]propyl]methanesulfonamide (PubChem CID 51104850) has the molecular formula C14H27N5O3S and a molecular weight of 345.47 g/mol. Its IUPAC name is N-[3-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]propyl]methanesulfonamide.
| Compound Name | N-[3-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 51104850 |
| Molecular Formula | C14H27N5O3S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-[3-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]propyl]methanesulfonamide |
| SMILES | Cc1nn(C)c(N2CCOCC2)c1CNCCCNS(C)(=O)=O |
| InChI | InChI=1S/C14H27N5O3S/c1-12-13(11-15-5-4-6-16-23(3,20)21)14(18(2)17-12)19-7-9-22-10-8-19/h15-16H,4-11H2,1-3H3 |
| InChIKey | WURACTRUFPMDOY-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|