About 3-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]azepan-2-one
3-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]azepan-2-one (PubChem CID 51104975) has the molecular formula C14H25N5O
and a molecular weight of 279.39 g/mol. Its IUPAC name is 3-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]azepan-2-one.
Molecular Properties
| Compound Name | 3-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]azepan-2-one |
| PubChem CID | 51104975 |
| Molecular Formula | C14H25N5O |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 3-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]azepan-2-one |
| SMILES | Cc1nn(C)c(N(C)C)c1CNC1CCCCNC1=O |
| InChI | InChI=1S/C14H25N5O/c1-10-11(14(18(2)3)19(4)17-10)9-16-12-7-5-6-8-15-13(12)20/h12,16H,5-9H2,1-4H3,(H,15,20) |
| InChIKey | DRRCORWLSUBENU-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]azepan-2-one?
The IUPAC name of 3-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]azepan-2-one (CID 51104975) is 3-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]azepan-2-one.
What is the SMILES notation for 3-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]azepan-2-one?
The canonical SMILES for 3-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]azepan-2-one is Cc1nn(C)c(N(C)C)c1CNC1CCCCNC1=O.
What is the InChIKey of 3-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]azepan-2-one?
The InChIKey is DRRCORWLSUBENU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N5O/c1-10-11(14(18(2)3)19(4)17-10)9-16-12-7-5-6-8-15-13(12)20/h12,16H,5-9H2,1-4H3,(H,15,20).
What are the key properties of 3-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]azepan-2-one?
3-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]azepan-2-one has a molecular weight of 279.39 g/mol, XLogP of 0.55, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(dimethylamino)-1,3-dimethylpyrazol-4-yl]methylamino]azepan-2-one is sourced from PubChem (CID 51104975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).