C20H31N5 — CID 51105393
N,N,1,3-tetramethyl-4-[[(4-piperidin-1-ylphenyl)methylamino]methyl]pyrazol-5-amine (PubChem CID 51105393) has the molecular formula C20H31N5 and a molecular weight of 341.50 g/mol. Its IUPAC name is N,N,1,3-tetramethyl-4-[[(4-piperidin-1-ylphenyl)methylamino]methyl]pyrazol-5-amine.
| Compound Name | N,N,1,3-tetramethyl-4-[[(4-piperidin-1-ylphenyl)methylamino]methyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 51105393 |
| Molecular Formula | C20H31N5 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | N,N,1,3-tetramethyl-4-[[(4-piperidin-1-ylphenyl)methylamino]methyl]pyrazol-5-amine |
| SMILES | Cc1nn(C)c(N(C)C)c1CNCc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H31N5/c1-16-19(20(23(2)3)24(4)22-16)15-21-14-17-8-10-18(11-9-17)25-12-6-5-7-13-25/h8-11,21H,5-7,12-15H2,1-4H3 |
| InChIKey | UGSWVUBKWONTQP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|