About 3-(cyclooctylamino)-5,5-dimethylcyclohex-2-en-1-one
3-(cyclooctylamino)-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 5110555) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is 3-(cyclooctylamino)-5,5-dimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-(cyclooctylamino)-5,5-dimethylcyclohex-2-en-1-one |
| PubChem CID | 5110555 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 3-(cyclooctylamino)-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | CC1(C)CC(=O)C=C(NC2CCCCCCC2)C1 |
| InChI | InChI=1S/C16H27NO/c1-16(2)11-14(10-15(18)12-16)17-13-8-6-4-3-5-7-9-13/h10,13,17H,3-9,11-12H2,1-2H3 |
| InChIKey | MNYRTJJMZYULRL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(cyclooctylamino)-5,5-dimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclooctylamino)-5,5-dimethylcyclohex-2-en-1-one?
The IUPAC name of 3-(cyclooctylamino)-5,5-dimethylcyclohex-2-en-1-one (CID 5110555) is 3-(cyclooctylamino)-5,5-dimethylcyclohex-2-en-1-one.
What is the SMILES notation for 3-(cyclooctylamino)-5,5-dimethylcyclohex-2-en-1-one?
The canonical SMILES for 3-(cyclooctylamino)-5,5-dimethylcyclohex-2-en-1-one is CC1(C)CC(=O)C=C(NC2CCCCCCC2)C1.
What is the InChIKey of 3-(cyclooctylamino)-5,5-dimethylcyclohex-2-en-1-one?
The InChIKey is MNYRTJJMZYULRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO/c1-16(2)11-14(10-15(18)12-16)17-13-8-6-4-3-5-7-9-13/h10,13,17H,3-9,11-12H2,1-2H3.
What are the key properties of 3-(cyclooctylamino)-5,5-dimethylcyclohex-2-en-1-one?
3-(cyclooctylamino)-5,5-dimethylcyclohex-2-en-1-one has a molecular weight of 249.40 g/mol, XLogP of 3.96, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclooctylamino)-5,5-dimethylcyclohex-2-en-1-one is sourced from PubChem (CID 5110555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).